For research use only. Not for therapeutic Use.
Ovalene(CAT: R036762) is a polycyclic aromatic hydrocarbon (PAH) composed of five fused benzene rings. It is a compound of interest in the field of organic chemistry and materials science due to its unique structure and properties. Ovalene is known for its aromaticity and fluorescence, making it valuable in the study of organic electronic materials and luminescent properties.
| Catalog Number | R036762 |
| CAS Number | 190-26-1 |
| Synonyms | Circumnaphthalene; NSC 91578 |
| Molecular Formula | C32H14 |
| Purity | ≥95% |
| IUPAC Name | ovalene |
| InChI | InChI=1S/C32H14/c1-2-16-6-10-20-14-22-12-8-18-4-3-17-7-11-21-13-19-9-5-15(1)23-24(16)28(20)32-30(22)26(18)25(17)29(21)31(32)27(19)23/h1-14H |
| InChIKey | LSQODMMMSXHVCN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C4=C1C=CC5=CC6=C7C8=C(C=CC9=C8C1=C(C=C9)C=C(C3=C1C7=C54)C=C2)C=C6 |
