For research use only. Not for therapeutic Use.
Oxalacetic acid 4-methyl ester(Cat No.:M066362) is a derivative of oxalacetic acid, containing a methyl group attached to the fourth carbon atom of the ester functional group. With a molecular formula of C5H6O5, it plays a significant role in biochemical processes as an intermediate in the citric acid cycle, a key metabolic pathway in living organisms. This compound is synthesized for research purposes to investigate metabolic pathways and enzyme mechanisms. Additionally, it may have potential applications in pharmaceuticals and organic synthesis due to its structural similarity to oxaloacetate.
CAS Number | 13192-05-7 |
Molecular Formula | C5H6O5 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-methoxy-2,4-dioxobutanoic acid |
InChI | InChI=1S/C5H6O5/c1-10-4(7)2-3(6)5(8)9/h2H2,1H3,(H,8,9) |
InChIKey | MAIRDOOJJIGWBJ-UHFFFAOYSA-N |
SMILES | COC(=O)CC(=O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |