For research use only. Not for therapeutic Use.
Oxaliplatin（Cat No.:A001065）is a platinum-based chemotherapy drug used primarily to treat colorectal cancer, often in combination with other agents like fluorouracil and leucovorin (FOLFOX regimen). It works by forming cross-links with DNA, disrupting DNA replication and transcription, ultimately leading to cell death. Oxaliplatin is particularly effective against rapidly dividing cancer cells and has shown promise in overcoming resistance to other platinum-based drugs like cisplatin. While effective, it can cause side effects such as neuropathy, which may limit its use. Oxaliplatin is a cornerstone in colorectal cancer treatment protocols.
| Catalog Number | A001065 |
| CAS Number | 61825-94-3 |
| Synonyms | Eloxatin (TN); Oxaliplatin (JAN/USAN/INN); Oxaliplatin (TN); Medac (TN); Oxaliplatin (Eloxatin); D0Y3ME |
| Molecular Formula | C8H14N2O4Pt |
| Purity | ≥95% |
| Target | DNA Synthesis |
| Solubility | Limited solubility |
| Storage | -20°C |
| IUPAC Name | [(1R,2R)-2-azanidylcyclohexyl]azanide;oxalic acid;platinum(2+) |
| InChI | InChI=1S/C6H12N2.C2H2O4.Pt/c7-5-3-1-2-4-6(5)8;3-1(4)2(5)6;/h5-8H,1-4H2;(H,3,4)(H,5,6);/q-2;;+2/t5-,6-;;/m1../s1 |
| InChIKey | DRMCATBEKSVAPL-BNTLRKBRSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)[NH-])[NH-].C(=O)(C(=O)O)O.[Pt+2] |
| Reference | 1: van Berlo-van de Laar IRF, Brummelhuis WJ, Imholz ALT, Schellens JH, Huitema 2: Viatchenko-Karpinski V, Ling J, Gu JG. Down-regulation of Kv4.3 channels and 3: Saeki H, Emi Y, Oki E, Tokunaga S, Kakeji Y, Akagi Y, Baba H, Baba E, Maehara <br> 5: Bullock A, Stuart K, Jacobus S, Abrams T, Wadlow R, Goldstein M, Miksad R. 6: Shen Y, Li C, Liu W, Mao W, Qian H, Wang H, Xu Q. Clinical Analysis of 7: Ando H, Abu Lila AS, Tanaka M, Doi Y, Terada Y, Yagi N, Shimizu T, Okuhira K, 8: Curtis SA, Curtis BR, Lee AI, Hendrickson JE, Lacy J, Podoltsev NA. A patient <br> <br> |
