For research use only. Not for therapeutic Use.
Oxamniquine(Cat No.:R025354)is an anthelmintic medication used primarily to treat schistosomiasis, a parasitic infection caused by Schistosoma mansoni. It works by causing paralysis and death of the parasite, thereby eliminating the infection. Oxamniquine is especially effective in regions where resistance to other treatments, such as praziquantel, has emerged. Its high efficacy and safety profile make it a valuable drug in public health efforts to control and eradicate schistosomiasis. High-purity Oxamniquine ensures consistent therapeutic outcomes, making it essential for both clinical use and ongoing parasitological research.
Catalog Number | R025354 |
CAS Number | 21738-42-1 |
Synonyms | Vansil; 1,2,3,4-Tetrahydro-2-[(isopropylamino)methyl]-7-nitro-6-quinolinemethanol; (±)-Oxamniquine; 1,2,3,4-Tetrahydro-6-(hydroxymethyl)-2-[(isopropylamino)methyl]-7-nitroquinoline;?6-Hydroxymethyl-2-isopropylaminomethyl-7-nitro-1,2,3,4-tetrahydroqui |
Molecular Formula | C14H21N3O3 |
Purity | ≥95% |
Target | Parasite |
Storage | -20°C |
IUPAC Name | [7-nitro-2-[(propan-2-ylamino)methyl]-1,2,3,4-tetrahydroquinolin-6-yl]methanol |
InChI | InChI=1S/C14H21N3O3/c1-9(2)15-7-12-4-3-10-5-11(8-18)14(17(19)20)6-13(10)16-12/h5-6,9,12,15-16,18H,3-4,7-8H2,1-2H3 |
InChIKey | XCGYUJZMCCFSRP-UHFFFAOYSA-N |
SMILES | CC(C)NCC1CCC2=CC(=C(C=C2N1)[N+](=O)[O-])CO |