For research use only. Not for therapeutic Use.
Oxaprozin (Cat No.: A001002)is a nonsteroidal anti-inflammatory drug (NSAID) used to treat pain and inflammation associated with conditions like osteoarthritis and rheumatoid arthritis. It works by inhibiting cyclooxygenase (COX) enzymes, particularly COX-1 and COX-2, which are involved in the production of prostaglandins that cause inflammation and pain. Oxaprozin has a longer half-life compared to many other NSAIDs, allowing for once-daily dosing. Potential side effects include gastrointestinal issues, kidney problems, and cardiovascular risks, especially with long-term use.
| Catalog Number | A001002 |
| CAS Number | 21256-18-8 |
| Synonyms | Daypro; Alvo; 3-(4,5-Diphenyl-1,3-oxazol-2-yl)propanoic acid; Oxaprozine |
| Molecular Formula | C18H15NO3 |
| Purity | ≥95% |
| Target | NF-κB |
| Storage | -20°C |
| IUPAC Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid |
| InChI | 1S/C18H15NO3/c20-16(21)12-11-15-19-17(13-7-3-1-4-8-13)18(22-15)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,20,21) |
| InChIKey | OFPXSFXSNFPTHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC(=N2)CCC(=O)O)C3=CC=CC=C3 |
