For research use only. Not for therapeutic Use.
Oxepane-2,7-dione (Cat.No:M015010) is a cyclic compound with a seven-membered ring containing two carbonyl groups. It is of interest in organic chemistry for its unique structure and potential reactivity. Oxepane-2,7-dione may find applications in the synthesis of complex molecules and as a building block in pharmaceutical and materials science research.
Catalog Number | M015010 |
CAS Number | 2035-75-8 |
Synonyms | ADIPIC ANHYDRIDE;2,7-oxepanedione;Hexahydrooxepin-2,7-dione;Oxepane-2,7-dione;Hexanedioic anhydride |
Molecular Formula | C6H8O3 |
Purity | 90% |
Storage | 20°C |
IUPAC Name | oxepane-2,7-dione |
InChI | InChI=1S/C6H8O3/c7-5-3-1-2-4-6(8)9-5/h1-4H2 |
InChIKey | JPSKCQCQZUGWNM-UHFFFAOYSA-N |
SMILES | C1CCC(=O)OC(=O)C1 |