For research use only. Not for therapeutic Use.
Oxfendazole is the sulfoxide form of fenbendazole, which fights parasites.
| Catalog Number | I046394 |
| CAS Number | 53716-50-0 |
| Synonyms | methyl N-[6-(benzenesulfinyl)-1H-benzimidazol-2-yl]carbamate |
| Molecular Formula | C15H13N3O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C15H13N3O3S/c1-21-15(19)18-14-16-12-8-7-11(9-13(12)17-14)22(20)10-5-3-2-4-6-10/h2-9H,1H3,(H2,16,17,18,19) |
| InChIKey | BEZZFPOZAYTVHN-UHFFFAOYSA-N |
| SMILES | COC(=O)NC1=NC2=C(N1)C=C(C=C2)S(=O)C3=CC=CC=C3 |
| Reference | [1]. Alvarez, L., et al., Efficacy of a single high oxfendazole dose against gastrointestinal nematodes in naturally infected pigs. Veterinary parasitology, 2013. 194(1): p. 70-74. |
