For research use only. Not for therapeutic Use.
Oxindole（Cat No.:R009444）, also known as 2-indolone, is a heterocyclic organic compound. Oxindole is a derivative of indole and is found in various natural sources, including plants and microorganisms. It serves as a key building block for the synthesis of various biologically active molecules and pharmaceutical compounds. Oxindole derivatives have shown diverse pharmacological activities, including antimicrobial, anti-inflammatory, anticancer, and neuroprotective properties, making them of interest in drug discovery and development.
| Catalog Number | R009444 |
| CAS Number | 59-48-3 |
| Synonyms | 1,3-Dihydro-2H-indol-2-one; 2-Indolinone; Oxindole; 1,3-Dihydroindol-2-one; 2-Oxindole; 2-Oxo-2,3-dihydroindole; 2-Oxoindole; 2-Oxoindoline; Indol-2(3H)-one; Indoline-2-one; NSC 274863; Oxindol; |
| Molecular Formula | C₈H₇NO |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 1,3-dihydroindol-2-one |
| InChI | InChI=1S/C8H7NO/c10-8-5-6-3-1-2-4-7(6)9-8/h1-4H,5H2,(H,9,10) |
| InChIKey | JYGFTBXVXVMTGB-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2NC1=O |
