For research use only. Not for therapeutic Use.
Oxindole (Cat No.:R009444) is a versatile heterocyclic compound featuring an indole framework with a ketone group at the 2-position. This structure makes it a valuable building block in synthetic chemistry and pharmaceutical research. Oxindole serves as a precursor in the synthesis of various bioactive molecules, including alkaloids and drug candidates. It exhibits biological activities such as anti-inflammatory, anticancer, and antimicrobial properties, making it significant in drug discovery and medicinal chemistry. Oxindole is also widely used in the development of materials and dyes, demonstrating its broad applicability.
CAS Number | 59-48-3 |
Synonyms | 1,3-Dihydro-2H-indol-2-one; 2-Indolinone; Oxindole; 1,3-Dihydroindol-2-one; 2-Oxindole; 2-Oxo-2,3-dihydroindole; 2-Oxoindole; 2-Oxoindoline; Indol-2(3H)-one; Indoline-2-one; NSC 274863; Oxindol; |
Molecular Formula | C₈H₇NO |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | Store at RT |
IUPAC Name | 1,3-dihydroindol-2-one |
InChI | InChI=1S/C8H7NO/c10-8-5-6-3-1-2-4-7(6)9-8/h1-4H,5H2,(H,9,10) |
InChIKey | JYGFTBXVXVMTGB-UHFFFAOYSA-N |
SMILES | C1C2=CC=CC=C2NC1=O |