Home
>
Chemical Reagents>Organic Building Blocks> Oxirane, 2,2'-[9H-fluoren-9-ylidenebis(4,1-phenyleneoxymethylene)]bis-
For research use only. Not for therapeutic Use.
Oxirane, 2,2′-[9H-fluoren-9-ylidenebis(4,1-phenylene oxymethylene)]bis-(Cat No.:L006821), is a complex organic compound featuring a fluorene-based structure with two oxiranes (epoxy) groups bridged by a phenylene moiety. This compound’s unique architecture makes it valuable in various applications, including polymer chemistry and material science. It serves as a monomer for the synthesis of specialized polymers and resins, contributing to the development of materials with specific properties.
CAS Number | 47758-37-2 |
Molecular Formula | C31H26O4 |
Purity | ≥95% |
IUPAC Name | 2-[[4-[9-[4-(oxiran-2-ylmethoxy)phenyl]fluoren-9-yl]phenoxy]methyl]oxirane |
InChI | InChI=1S/C31H26O4/c1-3-7-29-27(5-1)28-6-2-4-8-30(28)31(29,21-9-13-23(14-10-21)32-17-25-19-34-25)22-11-15-24(16-12-22)33-18-26-20-35-26/h1-16,25-26H,17-20H2 |
InChIKey | LCSAOPVSVLGDLE-UHFFFAOYSA-N |
SMILES | C1C(O1)COC2=CC=C(C=C2)C3(C4=CC=CC=C4C5=CC=CC=C53)C6=CC=C(C=C6)OCC7CO7 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |