For research use only. Not for therapeutic Use.
Oxymatrine is a naturally occurring alkaloid extracted from the roots of Sophora species. It exhibits a wide range of pharmacological activities, including anti-inflammatory, antiviral, and anticancer properties. Oxymatrine modulates signaling pathways such as NF-κB and TGF-β, making it valuable for research on immune regulation and fibrosis. It has been studied for its potential in treating hepatitis, certain cancers, and inflammatory disorders. Its diverse bioactivity makes oxymatrine a critical compound for advancing studies in pharmacology and therapeutic development.
CAS Number | 16837-52-8 |
Synonyms | (1β)-Matridin-15-one 1-Oxide; Matrine 1-Oxide; Matrine N-Oxide; (+)-Matrine N-Oxide; (+)-Oxymatrine; [4R-(4α,7aβ,13aα,13bβ,13cβ)]-Dodecahydro-1H,5H,10H-dipyrido[2,1-f:3’,2’,1’-ij][1,6]naphthyridin-10-one 4-Oxide, ; Ammothamnine; Matrine 1β-Oxide; Mat |
Molecular Formula | C15H24N2O2 |
Purity | ≥95% |
Target | TGF-beta/Smad |
Storage | -20 ℃ |
IUPAC Name | (1R,2R,9S,17S)-13-oxido-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
InChI | 1S/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-,17?/m0/s1 |
InChIKey | XVPBINOPNYFXID-LHDUFFHYSA-N |
SMILES | C1C[C@@H]2[C@H]3CCC[N+]4([C@H]3[C@@H](CCC4)CN2C(=O)C1)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |