For research use only. Not for therapeutic Use.
Oxyphenbutazone is a non-steroidal anti-inflammatory drug (NSAID) known for its potent anti-inflammatory, analgesic, and antipyretic properties. It works by inhibiting cyclooxygenase (COX) enzymes, reducing prostaglandin synthesis and alleviating inflammation and pain. Oxyphenbutazone has been studied for its applications in treating conditions such as arthritis and other inflammatory disorders. Although less commonly used today due to newer NSAIDs with improved safety profiles, it remains a valuable compound in pharmacological research for understanding inflammation and drug development.
| Catalog Number | R010606 |
| CAS Number | 129-20-4 |
| Synonyms | 4-Butyl-1-(4-hydroxyphenyl)-2-phenyl-3,5-pyrazolidinedione; 1-Phenyl-2-(p-hydroxyphenyl)-3,5-dioxo-4-butylpyrazolidine; Butapirone; Californit; Crovaril; Oxyphenobutazone; Oxyphenylbutazone; Rapostan; p-Hydroxyphenylbutazone; Visubutina; |
| Molecular Formula | C19H20N2O3 |
| Purity | ≥95% |
| Target | Anti-infection |
| Storage | -20°C |
| IUPAC Name | 4-butyl-1-(4-hydroxyphenyl)-2-phenylpyrazolidine-3,5-dione |
| InChI | InChI=1S/C19H20N2O3/c1-2-3-9-17-18(23)20(14-7-5-4-6-8-14)21(19(17)24)15-10-12-16(22)13-11-15/h4-8,10-13,17,22H,2-3,9H2,1H3 |
| InChIKey | HFHZKZSRXITVMK-UHFFFAOYSA-N |
| SMILES | CCCCC1C(=O)N(N(C1=O)C2=CC=C(C=C2)O)C3=CC=CC=C3 |
