For research use only. Not for therapeutic Use.
oxyphenisatine di(acetate)(Cat No.:M068509) is a chemical substance used in clinical drugs. Upon oral administration, it undergoes gradual decomposition into acetic acid and phenolate when it encounters alkaline intestinal juice. Phenolate exerts a significantly stronger stimulatory effect on the intestinal mucosa, resulting in a more potent catharsis effect. This enhanced catharsis makes diacetate a valuable component in medications designed to promote bowel movements and relieve constipation effectively.
CAS Number | 115-33-3 |
Molecular Formula | C24H19NO5 |
Purity | ≥95% |
Target | Autophagy |
Storage | -20°C |
IUPAC Name | [4-[3-(4-acetyloxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] acetate |
InChI | InChI=1S/C24H19NO5/c1-15(26)29-19-11-7-17(8-12-19)24(18-9-13-20(14-10-18)30-16(2)27)21-5-3-4-6-22(21)25-23(24)28/h3-14H,1-2H3,(H,25,28) |
InChIKey | PHPUXYRXPHEJDF-UHFFFAOYSA-N |
SMILES | CC(=O)OC1=CC=C(C=C1)C2(C3=CC=CC=C3NC2=O)C4=CC=C(C=C4)OC(=O)C |