For research use only. Not for therapeutic Use.
Oxyphyllacinol（Cat No.:I043274）is a bioactive compound with promising potential in various therapeutic applications. It is derived from natural sources and exhibits antioxidant, anti-inflammatory, and antimicrobial properties. Research indicates that oxyphyllacinol may offer benefits in treating conditions such as cardiovascular diseases, metabolic disorders, and neurological diseases. Its mechanism of action involves the modulation of key signaling pathways, contributing to the regulation of oxidative stress and inflammation. Oxyphyllacinol shows potential as a therapeutic agent in clinical settings, offering an alternative or adjunctive treatment option for several chronic health conditions.
| CAS Number | 87657-77-0 |
| Synonyms | 4-(3-hydroxy-7-phenylheptyl)-2-methoxyphenol |
| Molecular Formula | C20H26O3 |
| Purity | ≥95% |
| IUPAC Name | 4-(3-hydroxy-7-phenylheptyl)-2-methoxyphenol |
| InChI | InChI=1S/C20H26O3/c1-23-20-15-17(12-14-19(20)22)11-13-18(21)10-6-5-9-16-7-3-2-4-8-16/h2-4,7-8,12,14-15,18,21-22H,5-6,9-11,13H2,1H3 |
| InChIKey | DHUCMVAZNHOIPY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CCC(CCCCC2=CC=CC=C2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
