For research use only. Not for therapeutic Use.
Oxytetracycline calcium salt is the calcium complex of oxytetracycline, a broad-spectrum antibiotic belonging to the tetracycline class. It is used to treat various bacterial infections by inhibiting protein synthesis in bacteria, thereby preventing their growth and replication. The calcium salt form provides enhanced stability and is often used in veterinary medicine, agriculture, and aquaculture to control infections in animals and livestock. Oxytetracycline calcium salt is also employed in some formulations for human use, particularly where a longer-acting or less soluble form of the antibiotic is required.
Catalog Number | M064089 |
CAS Number | 13303-91-8 |
Synonyms | Oxytetracycline calcium; |
Molecular Formula | C44H46CaN4O18 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | calcium;(6aR,10S,10aR,11S,11aR,12S)-8-carbamoyl-10-(dimethylamino)-4,6a,7,11,12-pentahydroxy-12-methyl-6,9-dioxo-10,10a,11,11a-tetrahydrotetracen-5-olate |
InChI | InChI=1S/2C22H24N2O9.Ca/c2*1-21(32)7-5-4-6-8(25)9(7)15(26)10-12(21)17(28)13-14(24(2)3)16(27)11(20(23)31)19(30)22(13,33)18(10)29;/h2*4-6,12-14,17,25-26,28,30,32-33H,1-3H3,(H2,23,31);/q;;+2/p-2/t2*12-,13-,14+,17+,21-,22+;/m11./s1 |
InChIKey | VANYVCHXDYVKSI-MXWBXKMOSA-L |
SMILES | CC1(C2C(C3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)[O-])O)O)C(=O)N)N(C)C)O)O.CC1(C2C(C3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)[O-])O)O)C(=O)N)N(C)C)O)O.[Ca+2] |