For research use only. Not for therapeutic Use.
p-Nitro-m-cresol is an aromatic organic compound characterized by the presence of a nitro group (-NO₂) at the para position and a hydroxyl group (-OH) at the meta position relative to a methyl group on a benzene ring. This compound is a derivative of cresol and is commonly used as an intermediate in the synthesis of dyes, pharmaceuticals, and agrochemicals. The nitro group enhances its reactivity, making it suitable for further chemical modifications. p-Nitro-m-cresol is also studied for its antimicrobial properties, and its derivatives are often used in formulations for wood preservatives and antiseptics. Its chemical structure and properties make it valuable in various industrial and research applications.
CAS Number | 2581-34-2 |
Synonyms | 2-Nitro-5-hydroxytoluene; 3-Methyl-4-nitrophenol; 4-Nitro-3-methylphenol; 4-Nitro-5-methylphenol; 4-Nitro-m-cresol; 5-Hydroxy-2-nitrotoluene; 5-Methyl-4-nitrophenol; NSC 69190; p-Nitro-m-methylphenol |
Molecular Formula | C7H7NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-methyl-4-nitrophenol |
InChI | InChI=1S/C7H7NO3/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4,9H,1H3 |
InChIKey | PIIZYNQECPTVEO-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)O)[N+](=O)[O-] |