For research use only. Not for therapeutic Use.
p-Toluenesulfonyl Chloride (Cat.No:R019775) is a versatile chemical compound used in organic synthesis. It acts as a sulfonylating agent, introducing the tosyl group (-SO2C6H4CH3) into molecules. This reactive compound is employed in pharmaceutical and chemical industries for creating a wide range of compounds with specific functionalities.
Catalog Number | R019775 |
CAS Number | 98-59-9 |
Synonyms | p-Toluenesulfonyl Chloride; 4-Methylbenzene-1-sulfonyl Chloride; 4-Methylbenzenesulfonyl Chloride; 4-Methylphenylsulfonyl Chloride; 4-Toluenesulfonyl Chloride; 4-Toluolsulfonyl Chloride; 4-Tosyl Chloride; NSC 175822; Toluenesulfonyl Chloride; Tosyl |
Molecular Formula | C7H7ClO2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-methylbenzenesulfonyl chloride |
InChI | InChI=1S/C7H7ClO2S/c1-6-2-4-7(5-3-6)11(8,9)10/h2-5H,1H3 |
InChIKey | YYROPELSRYBVMQ-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)Cl |