For research use only. Not for therapeutic Use.
P 22077(Cat No.:I000989)is a synthetic chemical compound utilized in biomedical and pharmaceutical research, particularly for its role in modulating specific biological pathways. Known for its potency and specificity, it is often used to investigate cellular mechanisms and potential therapeutic targets. Its high purity and stability ensure consistent and reliable results in experimental studies. P 22077 is valuable in the development of new drugs and treatments, contributing to advancements in understanding disease mechanisms and creating innovative therapeutic strategies, thereby playing a crucial role in modern medical research.
CAS Number | 1247819-59-5 |
Synonyms | 1-[5-(2,4-difluorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone |
Molecular Formula | C12H7F2NO3S2 |
Purity | ≥95% |
IUPAC Name | 1-[5-(2,4-difluorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone |
InChI | InChI=1S/C12H7F2NO3S2/c1-6(16)11-5-9(15(17)18)12(20-11)19-10-3-2-7(13)4-8(10)14/h2-5H,1H3 |
InChIKey | RMAMGGNACJHXHO-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC(=C(S1)SC2=C(C=C(C=C2)F)F)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |