For research use only. Not for therapeutic Use.
p-Benzoquinone (Cat. No: R020908) is a quinone compound used to make hydroquinone and rubber antioxidant, acrylonitrile and vinyl acetate polymerization initiator and oxidant, etc.
| Catalog Number | R020908 |
| CAS Number | 106-51-4 |
| Synonyms | 1,4-Benzoquinone; 1,4-Cyclohexadienedione; 1,4-Dione-2,5-cyclohexadiene; Chinone; NSC 36324; PBQ 2; Quinone; Stearer PBQ; p-Quinone |
| Molecular Formula | C6H4O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione |
| InChI | InChI=1S/C6H4O2/c7-5-1-2-6(8)4-3-5/h1-4H |
| InChIKey | AZQWKYJCGOJGHM-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C=CC1=O |
