For research use only. Not for therapeutic Use.
p-Coumaric acid ethyl ester is an ester derivative of p-coumaric acid, a compound found in various plants. It is utilized in the food and beverage industry as a flavoring agent due to its pleasant aroma and taste. Additionally, p-coumaric acid ethyl ester has antioxidant properties, contributing to its potential use in cosmetics and pharmaceuticals for its protective effects against oxidative stress.
CAS Number | 7362-39-2 |
Molecular Formula | C11H12O3 |
Purity | ≥95% |
Target | Drug Metabolite |
Storage | -20 ℃ |
IUPAC Name | ethyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
InChI | InChI=1S/C11H12O3/c1-2-14-11(13)8-5-9-3-6-10(12)7-4-9/h3-8,12H,2H2,1H3/b8-5+ |
InChIKey | ZOQCEVXVQCPESC-VMPITWQZSA-N |
SMILES | CCOC(=O)C=CC1=CC=C(C=C1)O |