For research use only. Not for therapeutic Use.
p-Cyanophenyl isothiocyanate (Cat.No:R017440) is a chemical compound used in organic synthesis. It contains both a cyanophenyl and an isothiocyanate group, making it valuable as a reagent in various reactions. It can react with nucleophiles to form thiourea derivatives, making it useful in the preparation of diverse compounds in medicinal and synthetic chemistry.
CAS Number | 2719-32-6 |
Synonyms | 4-Cyanophenyl isothiocyanate; 4-Isothiocyanatobenzonitrile; p-Cyanophenyl Ester Isothiocyanic Acid; 4-Isothiocyanatobenzonitrile |
Molecular Formula | C8H4N2S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-isothiocyanatobenzonitrile |
InChI | InChI=1S/C8H4N2S/c9-5-7-1-3-8(4-2-7)10-6-11/h1-4H |
InChIKey | DZFKAXLNKZXNHD-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C#N)N=C=S |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |