For research use only. Not for therapeutic Use.
P-DIAZO-N, N-DIETHYLANILINE ZINC CHLORIDE (Cat. No: M086947) is a transition metal compound that can be used as a pharmaceutical intermediate for the preparation of chemical raw materials, mainly for scientific research.
CAS Number | 17409-47-1 |
Molecular Formula | C10H14Cl3N3Zn |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | dichlorozinc;4-(diethylamino)benzenediazonium;chloride |
InChI | InChI=1S/C10H14N3.3ClH.Zn/c1-3-13(4-2)10-7-5-9(12-11)6-8-10;;;;/h5-8H,3-4H2,1-2H3;3*1H;/q+1;;;;+2/p-3 |
InChIKey | YLGBZMRWHAZPIE-UHFFFAOYSA-K |
SMILES | CCN(CC)C1=CC=C(C=C1)[N+]#N.[Cl-].Cl[Zn]Cl |