For research use only. Not for therapeutic Use.
p-Nitrophenyl 2-(furfurylsulfinyl)acetate is a chemical compound characterized by a nitrophenyl ester linked to a furfurylsulfinyl group attached to the acetate moiety. This compound is notable for its potential use as a substrate or reagent in organic synthesis, particularly in enzymatic or chemical transformations. The furfurylsulfinyl group can confer specific reactivity or stability, while the nitrophenyl ester functionality may be important in enzymatic assays or prodrug design. Its synthesis involves strategic coupling of appropriate functional groups.
CAS Number | 123855-55-0 |
Synonyms | 2-[(2-Furanylmethyl)sulfinyl]acetic Acid 4-Nitrophenyl Ester; [(2-Furanylmethyl)sulfinyl]acetic Acid 4-Nitrophenyl Ester; |
Molecular Formula | C13H11NO6S |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-(furan-2-ylmethylsulfinyl)-2-(4-nitrophenyl)acetic acid |
InChI | InChI=1S/C13H11NO6S/c15-13(16)12(21(19)8-11-2-1-7-20-11)9-3-5-10(6-4-9)14(17)18/h1-7,12H,8H2,(H,15,16) |
InChIKey | DNKPBQVNNBANEQ-UHFFFAOYSA-N |
SMILES | C1=COC(=C1)CS(=O)C(C2=CC=C(C=C2)[N+](=O)[O-])C(=O)O |