For research use only. Not for therapeutic Use.
p-Phenylene diisothiocyanate(Cat No.:I003467)is an organic compound featuring two isothiocyanate groups attached to a benzene ring. Known for its reactivity, it serves as a versatile cross-linking agent in polymer chemistry, aiding in the development of advanced materials. In biochemical research, it is used to modify proteins and enzymes by reacting with amino groups, enabling studies of protein structure and function. Additionally, it finds applications in synthesizing thiourea derivatives and other functionalized organic compounds. Its unique chemical properties make it valuable across various scientific and industrial domains.
CAS Number | 4044-65-9 |
Molecular Formula | C8H4N2S2 |
Purity | ≥95% |
Target | Parasite |
Solubility | 10 mM in DMSO |
Storage | 3 years -20C powder |
IUPAC Name | 1,4-diisothiocyanatobenzene |
InChI | InChI=1S/C8H4N2S2/c11-5-9-7-1-2-8(4-3-7)10-6-12/h1-4H |
InChIKey | OMWQUXGVXQELIX-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1N=C=S)N=C=S |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |