For research use only. Not for therapeutic Use.
p-Terphenyl-d14 is a deuterated aromatic hydrocarbon used as an internal standard in nuclear magnetic resonance (NMR) spectroscopy. Its deuterium labeling provides enhanced accuracy in quantitative analysis. This compound is valuable in studying molecular interactions and structural elucidation in complex organic systems, making it essential in advanced chemical research and analytical applications.
Catalog Number | R025926 |
CAS Number | 1718-51-0 |
Synonyms | 1,1’:4’,1’’-Terphenyl-d14; 4-Phenyl-1,1’-biphenyl-d14; 1,4-Diphenylbenzene-d14; 4-Phenylbiphenyl-d14; NSC 6810-d14; PT-d14; PTP-d14; Santowax P-d14; T 3203-d14; TP-d14; TP (scintillator)-d14; p-Diphenylbenzene-d14; p-Phenylene Trimer-d14; p-Triphenyl |
Molecular Formula | C18H14 |
Purity | ≥95% |
Storage | Store at -20 ℃ |
IUPAC Name | 1,2,3,4,5-pentadeuterio-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzene |
InChI | InChI=1S/C18H14/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16/h1-14H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D |
InChIKey | XJKSTNDFUHDPQJ-WZAAGXFHSA-N |
SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=CC=C3 |