For research use only. Not for therapeutic Use.
p-Tolyl isocyanate (Cat.No:L003636) is a key organic compound extensively used in the field of chemical synthesis and industrial applications. Its isocyanate functional group imparts reactivity, making it invaluable for the production of polyurethanes, pharmaceuticals, and agrochemicals. The compound’s versatility and widespread use in diverse industries emphasize its significance in modern chemistry. p-Tolyl isocyanate is a fundamental building block in the creation of essential materials and chemicals that impact everyday life.
| Catalog Number | L003636 |
| CAS Number | 622-58-2 |
| Molecular Formula | C8H7NO |
| Purity | ≥95% |
| IUPAC Name | 1-isocyanato-4-methylbenzene |
| InChI | InChI=1S/C8H7NO/c1-7-2-4-8(5-3-7)9-6-10/h2-5H,1H3 |
| InChIKey | MGYGFNQQGAQEON-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N=C=O |
