For research use only. Not for therapeutic Use.
p-Tolyl sulfate potassium salt is a chemical compound. It consists of a potassium cation (K+) and a sulfate anion (SO4^2-) attached to a para-tolyl group (C6H4CH3). This compound is used in various chemical and industrial applications, including as a reagent in organic synthesis or as a precursor in the preparation of other organic compounds. Its properties and solubility make it useful in certain chemical processes where a sulfate-containing reagent is required.
CAS Number | 91978-69-7 |
Synonyms | Mono(4-methylphenyl) Ester Sulfuric Acid Potassium Salt; p-Methylphenyl Potassium Sulfate; p-Cresol Sulfate Potassium Salt |
Molecular Formula | C7H7KO4S |
Purity | ≥95% |
Target | MAPK/ERK Pathway |
Storage | -20°C |
IUPAC Name | potassium;(4-methylphenyl) sulfate |
InChI | InChI=1S/C7H8O4S.K/c1-6-2-4-7(5-3-6)11-12(8,9)10;/h2-5H,1H3,(H,8,9,10);/q;+1/p-1 |
InChIKey | HTSFIPMTBJHYFQ-UHFFFAOYSA-M |
SMILES | CC1=CC=C(C=C1)OS(=O)(=O)[O-].[K+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |