For research use only. Not for therapeutic Use.
P18IN003 is a potent p18(INK4C) inhibitor andspecifically block the activity of p18 protein. P18IN003 has the potential to be aneffective chemical agent for therapeutic expansion of HSC[1].
| Catalog Number | I034114 |
| CAS Number | 71727-40-7 |
| Synonyms | 4,5-bis(4-methoxyphenyl)-1,3-dihydroimidazol-2-one |
| Molecular Formula | C17H16N2O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H16N2O3/c1-21-13-7-3-11(4-8-13)15-16(19-17(20)18-15)12-5-9-14(22-2)10-6-12/h3-10H,1-2H3,(H2,18,19,20) |
| InChIKey | JOTSGKDUQMLZLE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(NC(=O)N2)C3=CC=C(C=C3)OC |
