For research use only. Not for therapeutic Use.
P18IN00 (Cat No.: I034114) is a small-molecule inhibitor targeting cyclin-dependent kinase inhibitor p18<sup>INK4c</sup>, a protein involved in cell cycle regulation through inhibition of CDK4 and CDK6. By modulating p18<sup>INK4c</sup> activity, P18IN00 can influence the G1 to S phase transition, promoting controlled cell proliferation. It is primarily used in cancer research to investigate pathways related to cell cycle dysregulation and potential therapeutic strategies. P18IN00 serves as a valuable tool in understanding p18-associated mechanisms and developing novel treatments for cancers involving CDK pathway abnormalities.
| CAS Number | 71727-40-7 |
| Synonyms | 4,5-bis(4-methoxyphenyl)-1,3-dihydroimidazol-2-one |
| Molecular Formula | C17H16N2O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C17H16N2O3/c1-21-13-7-3-11(4-8-13)15-16(19-17(20)18-15)12-5-9-14(22-2)10-6-12/h3-10H,1-2H3,(H2,18,19,20) |
| InChIKey | JOTSGKDUQMLZLE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(NC(=O)N2)C3=CC=C(C=C3)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
