For research use only. Not for therapeutic Use.
P2X7 receptor antagonist-2(Cat No.:I042874)is a potent inhibitor of the P2X7 receptor, exhibiting a pIC₅₀ value between 6.5 and 7.5. The P2X7 receptor, a ligand-gated ion channel activated by extracellular ATP, plays a significant role in neuroinflammation and various neurological disorders. By antagonizing this receptor, P2X7 receptor antagonist-2 effectively combats neuroinflammatory responses, making it a valuable tool in researching treatments for conditions such as Alzheimer’s disease and amyotrophic lateral sclerosis (ALS). Its efficacy in modulating immune responses also positions it as a potential therapeutic agent in managing chronic pain and other inflammation-related pathologies.
CAS Number | 851269-75-5 |
Synonyms | 1-benzyl-N-[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-3-carboxamide |
Molecular Formula | C19H18Cl2N2O2 |
Purity | ≥95% |
IUPAC Name | 1-benzyl-N-[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-3-carboxamide |
InChI | InChI=1S/C19H18Cl2N2O2/c20-16-7-6-14(17(21)9-16)10-22-19(25)15-8-18(24)23(12-15)11-13-4-2-1-3-5-13/h1-7,9,15H,8,10-12H2,(H,22,25) |
InChIKey | NBEOSAFVNPGHAS-UHFFFAOYSA-N |
SMILES | C1C(CN(C1=O)CC2=CC=CC=C2)C(=O)NCC3=C(C=C(C=C3)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |