For research use only. Not for therapeutic Use.
P2X7 receptor antagonist-2 is a potent P2X7 receptor antagonist with a pIC50 value of 6.5-7.5. P2X7 receptor antagonist-2 has efficacy of combating neuroinflammation[1].
| Catalog Number | I042874 |
| CAS Number | 851269-75-5 |
| Synonyms | 1-benzyl-N-[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-3-carboxamide |
| Molecular Formula | C19H18Cl2N2O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C19H18Cl2N2O2/c20-16-7-6-14(17(21)9-16)10-22-19(25)15-8-18(24)23(12-15)11-13-4-2-1-3-5-13/h1-7,9,15H,8,10-12H2,(H,22,25) |
| InChIKey | NBEOSAFVNPGHAS-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=CC=CC=C2)C(=O)NCC3=C(C=C(C=C3)Cl)Cl |
| Reference | [1]. Steadman JGA, et, al. 5-oxo-3-pyrrolidinecarboxamide derivatives as p2x7 modulators. WO2009077559A2 |
