For research use only. Not for therapeutic Use.
p38 MAPK-IN-4（Cat No.:R065607）is a selective inhibitor of the p38 mitogen-activated protein kinase (MAPK), a key enzyme involved in regulating cellular responses to stress, inflammation, and apoptosis. The p38 MAPK pathway plays an important role in various diseases, including cancer, autoimmune disorders, and inflammatory conditions. By inhibiting p38 MAPK, p38 MAPK-IN-4 aims to reduce inflammation, promote cell survival, and modulate immune responses. This compound is being studied for its potential therapeutic applications in treating conditions such as rheumatoid arthritis, cardiovascular diseases, and other inflammatory or stress-related disorders.
| CAS Number | 219138-24-6 |
| Synonyms | 2-(4-chlorophenyl)-4-(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazol-3-one |
| Molecular Formula | C20H13ClFN3O |
| Purity | ≥95% |
| IUPAC Name | 2-(4-chlorophenyl)-4-(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazol-3-one |
| InChI | InChI=1S/C20H13ClFN3O/c21-15-3-7-17(8-4-15)25-20(26)18(13-1-5-16(22)6-2-13)19(24-25)14-9-11-23-12-10-14/h1-12,24H |
| InChIKey | DZFBYHUKZSRPHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(NN(C2=O)C3=CC=C(C=C3)Cl)C4=CC=NC=C4)F |
