For research use only. Not for therapeutic Use.
P5091（Cat No.:I005302）is a selective inhibitor of protein arginine methyltransferase 5 (PRMT5), an enzyme that catalyzes the methylation of arginine residues on histone and non-histone proteins. PRMT5 is involved in regulating gene expression, RNA processing, and cell survival, and its overactivity is linked to various cancers, including lymphoma, lung, and breast cancers. By inhibiting PRMT5, P5091 disrupts these processes, leading to impaired tumor growth and increased apoptosis in cancer cells. P5091 is currently being investigated in preclinical and clinical studies for its potential as a targeted cancer therapy.
| Catalog Number | I005302 |
| CAS Number | 882257-11-6 |
| Synonyms | P005091; 1-[5-(2,3-dichlorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone |
| Molecular Formula | C₁₂H₇Cl₂NO₃S₂ |
| Purity | ≥95% |
| Target | Deubiquitinase |
| Solubility | DMSO: 28 mg/mL, H2O: <1 mg/mL |
| Storage | Store at 4°C |
| IC50 | 4.2 uM (EC50) |
| IUPAC Name | 1-[5-(2,3-dichlorophenyl)sulfanyl-4-nitrothiophen-2-yl]ethanone |
| InChI | InChI=1S/C12H7Cl2NO3S2/c1-6(16)10-5-8(15(17)18)12(20-10)19-9-4-2-3-7(13)11(9)14/h2-5H,1H3 |
| InChIKey | LKZLGMAAKNEGCH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(S1)SC2=C(C(=CC=C2)Cl)Cl)[N+](=O)[O-] |
| Reference | 1. Cell Biochem Biophys. 2011 Jun;60(1-2):61-8. doi: 10.1007/s12013-011-9185-5. |
