For research use only. Not for therapeutic Use.
p53 Activator 3（Cat No.:I042489）is a small molecule compound designed to restore or enhance the activity of the tumor suppressor protein p53. p53 plays a crucial role in regulating cell cycle checkpoints, DNA repair, and apoptosis, especially in response to cellular stress. In many cancers, p53 is mutated or inactivated, allowing for uncontrolled cell growth. p53 Activator 3 works by reactivating p53, promoting the elimination of damaged or cancerous cells. This compound is being studied for its potential to treat tumors with p53 mutations or dysfunction, offering a novel approach to cancer therapy.
| CAS Number | 2636839-90-0 |
| Synonyms | 2-[2-[3-[4-[[4-(dimethylamino)cyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-5-methylsulfonylphenoxy]ethanol |
| Molecular Formula | C30H37F3N4O4S |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[3-[4-[[4-(dimethylamino)cyclohexyl]amino]-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-5-methylsulfonylphenoxy]ethanol |
| InChI | InChI=1S/C30H37F3N4O4S/c1-36(2)22-11-9-21(10-12-22)35-26-7-4-8-28-25(26)18-23(37(28)20-30(31,32)33)6-5-15-34-27-14-13-24(42(3,39)40)19-29(27)41-17-16-38/h4,7-8,13-14,18-19,21-22,34-35,38H,9-12,15-17,20H2,1-3H3 |
| InChIKey | NSHFHMCYOOBDBY-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCC(CC1)NC2=C3C=C(N(C3=CC=C2)CC(F)(F)F)C#CCNC4=C(C=C(C=C4)S(=O)(=O)C)OCCO |
