For research use only. Not for therapeutic Use.
p53 Activator 7（Cat No.:I042483）is a small molecule compound designed to activate the tumor suppressor protein p53, which plays a key role in regulating cell cycle progression, DNA repair, and apoptosis in response to cellular stress. By activating p53, p53 Activator 7 aims to enhance the cell’s ability to recognize and eliminate damaged or cancerous cells, offering potential therapeutic benefits in cancer treatment. This compound is being explored for its ability to restore or boost p53 function in tumors with mutated or inactivated p53, providing a novel strategy for cancer therapy.
| CAS Number | 2849340-59-4 |
| Synonyms | 2-[3-(4-dimethylphosphorylanilino)prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
| Molecular Formula | C27H32F3N4OP |
| Purity | ≥95% |
| IUPAC Name | 2-[3-(4-dimethylphosphorylanilino)prop-1-ynyl]-N-(1-methylpiperidin-4-yl)-1-(2,2,2-trifluoroethyl)indol-4-amine |
| InChI | InChI=1S/C27H32F3N4OP/c1-33-16-13-21(14-17-33)32-25-7-4-8-26-24(25)18-22(34(26)19-27(28,29)30)6-5-15-31-20-9-11-23(12-10-20)36(2,3)35/h4,7-12,18,21,31-32H,13-17,19H2,1-3H3 |
| InChIKey | TWHPNHHZQSJOEI-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)NC2=C3C=C(N(C3=CC=C2)CC(F)(F)F)C#CCNC4=CC=C(C=C4)P(=O)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
