For research use only. Not for therapeutic Use.
p53-MDM2-IN-1(Cat No.:I041453)is a small molecule inhibitor designed to disrupt the interaction between the tumor suppressor protein p53 and its negative regulator, MDM2. This interaction is critical in regulating p53’s role in cell cycle arrest, apoptosis, and tumor suppression. By inhibiting MDM2, p53-MDM2-IN-1 promotes the stabilization and activation of p53, which can lead to the induction of tumor cell death. It is being investigated as a potential therapeutic agent for various cancers, including those with p53 mutations or MDM2 overexpression, by reactivating the p53 pathway to restore normal cellular functions.
CAS Number | 381717-91-5 |
Synonyms | (4E)-5-(4-chlorophenyl)-4-[hydroxy(phenyl)methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
Molecular Formula | C23H20ClN3O3 |
Purity | ≥95% |
IUPAC Name | (4E)-5-(4-chlorophenyl)-4-[hydroxy(phenyl)methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
InChI | InChI=1S/C23H20ClN3O3/c24-18-9-7-16(8-10-18)20-19(21(28)17-5-2-1-3-6-17)22(29)23(30)27(20)13-4-12-26-14-11-25-15-26/h1-3,5-11,14-15,20,28H,4,12-13H2/b21-19+ |
InChIKey | JBSITHXZPKMWGY-XUTLUUPISA-N |
SMILES | C1=CC=C(C=C1)/C(=C\2/C(N(C(=O)C2=O)CCCN3C=CN=C3)C4=CC=C(C=C4)Cl)/O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |