For research use only. Not for therapeutic Use.
P7C3-A20 (CAT: I008535) is a member of the P7C3 family of neuroprotective compounds. It acts as a potent and selective antagonist of the apoptotic cell death pathway and exhibits neuroprotective effects. P7C3-A20 has been shown to promote the survival and growth of newborn neurons in the hippocampus, a brain region involved in learning and memory. It has also demonstrated efficacy in various models of neurodegenerative diseases, including Alzheimer’s disease, Parkinson’s disease, and amyotrophic lateral sclerosis (ALS). Additionally, P7C3-A20 has shown potential in enhancing cognitive function and improving behavioral outcomes.
| Catalog Number | I008535 |
| CAS Number | 1235481-90-9 |
| Synonyms | ;N-(3-(3,6-dibromo-9H-carbazol-9-yl)-2-fluoropropyl)-3-methoxyaniline |
| Molecular Formula | C22H19Br2FN2O |
| Purity | ≥95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| Related CAS | 1485572-67-5(hydrochloride) |
| InChI | InChI=1S/C22H19Br2FN2O/c1-28-18-4-2-3-17(11-18)26-12-16(25)13-27-21-7-5-14(23)9-19(21)20-10-15(24)6-8-22(20)27/h2-11,16,26H,12-13H2,1H3 |
| InChIKey | XNLTWMQBJFWQOU-UHFFFAOYSA-N |
| SMILES | COC1=CC(NCC(F)CN2C3=C(C4=C2C=CC(Br)=C4)C=C(Br)C=C3)=CC=C1 |
| Reference | 1: Loris ZB, Pieper AA, Dietrich WD. Corrigendum to /The neuroprotective compound |
