For research use only. Not for therapeutic Use.
Padsevonil (Cat.No:I008543) is an investigational antiepileptic drug that targets both gamma-aminobutyric acid (GABA) and serotonin receptors. It exhibits a dual mechanism of action, enhancing GABA signaling while reducing serotonin release. Preliminary studies suggest that padsevonil holds promise in the treatment of drug-resistant focal-onset seizures.
| Catalog Number | I008543 |
| CAS Number | 1294000-61-5 |
| Synonyms | Padsevonil; UCB-0942; UCB 0942; UCB0942;(R)-4-(2-chloro-2,2-difluoroethyl)-1-((2-(methoxymethyl)-6-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl)methyl)pyrrolidin-2-one |
| Molecular Formula | C14H14ClF5N4O2S |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | (4R)-4-(2-chloro-2,2-difluoroethyl)-1-[[2-(methoxymethyl)-6-(trifluoromethyl)imidazo[2,1-b][1,3,4]thiadiazol-5-yl]methyl]pyrrolidin-2-one |
| InChI | InChI=1S/C14H14ClF5N4O2S/c1-26-6-9-22-24-8(11(14(18,19)20)21-12(24)27-9)5-23-4-7(2-10(23)25)3-13(15,16)17/h7H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | DCXFIOLWWRXEQH-SSDOTTSWSA-N |
| SMILES | COCC1=NN2C(=C(N=C2S1)C(F)(F)F)CN3CC(CC3=O)CC(F)(F)Cl |
| Reference | <br /> |
