For research use only. Not for therapeutic Use.
Paederoside（Cat No.:R072649）is a naturally occurring iridoid glycoside found in certain medicinal plants, such as Paederia species, known for its potential health benefits. It exhibits antioxidant, anti-inflammatory, and antimicrobial properties, contributing to its use in traditional medicine for managing infections and inflammation. Paederoside has also shown promise in protecting cells against oxidative stress, which is beneficial for overall cellular health. Its natural origin and therapeutic potential make it a compound of interest in pharmacological research, with ongoing studies exploring its efficacy and possible applications in modern medicine for various conditions.
| Catalog Number | R072649 |
| CAS Number | 20547-45-9 |
| Molecular Formula | C18H22O11S |
| Purity | ≥95% |
| IUPAC Name | [(4S,7S,8S,11S)-2-oxo-8-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[5.3.1.04,11]undeca-1(10),5-dien-6-yl]methyl methylsulfanylformate |
| InChI | InChI=1S/C18H22O11S/c1-30-18(24)26-4-6-2-8-11-7(15(23)27-8)5-25-16(10(6)11)29-17-14(22)13(21)12(20)9(3-19)28-17/h2,5,8-14,16-17,19-22H,3-4H2,1H3/t8-,9+,10+,11-,12+,13-,14+,16-,17-/m0/s1 |
| InChIKey | OJISWUQNQQWEND-FCVLBCLDSA-N |
| SMILES | CSC(=O)OCC1=C[C@H]2[C@H]3[C@@H]1[C@@H](OC=C3C(=O)O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
