For research use only. Not for therapeutic Use.
PAF C-18:1 is a naturally occurring phospholipid produced by cells upon stimulation and plays a role in the establishment and maintenance of the inflammatory response. It is less potent than PAF C-16 (Item No. <span class=/itemid/>60900</span>) and PAF C-18 (Item No. <span class=/itemid/>60910</span>) in the induction of neutrophil chemotaxis, but is equipotent to PAF C-16 and PAF C-18 in promoting eosinophil migration. PAF C-18:1 activates the PAF receptor and has been used in antibody binding experiments to determine the importance of an acyl linkage at the <em>sn</em>-2 position for recognition at this receptor.
| Catalog Number | R065922 |
| CAS Number | 85966-90-1 |
| Synonyms | 1-Oleoyl-2-acetyl-sn-glycero-3-phosphorylcholine;Platelet-activating Factor C-18:1 |
| Molecular Formula | C28H56NO7P |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C28H56NO7P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-33-25-28(36-27(2)30)26-35-37(31,32)34-24-22-29(3,4)5/h13-14,28H,6-12,15-26H2,1-5H3/b14-13-/t28-/m1/s1 |
| InChIKey | ZBOQHUSCQCEBGK-JLRCLJKCSA-N |
| SMILES | CC(O[C@@H](COP(OCC[N+](C)(C)C)([O-])=O)COCCCCCCCC/C=CCCCCCCCC)=O |
| Reference | 1.Carolan, E.J. and Casale, T.B. Degree of platelet activating factor-induced neutrophil migration is dependent upon the molecular species. Journal of Immunology 145, 2561-2565 (1990). |
