For research use only. Not for therapeutic Use.
Palmatine chloride (Cat.No:I000305) is a natural alkaloid found in various plant sources, including Rhizoma Coptidis. It exhibits a wide range of pharmacological activities, such as antimicrobial, anti-inflammatory, antioxidant, and anticancer effects. Palmatine chloride has been studied for its potential therapeutic applications in various diseases, including cardiovascular disorders, diabetes, and cancer.
CAS Number | 10605-02-4 |
Molecular Formula | C21H22NO4.Cl |
Purity | ≥95% |
Target | Anti-infection |
Solubility | DMSO:32mg/mL |
Storage | 3 years -20℃ powder |
IUPAC Name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium;chloride |
InChI | InChI=1S/C21H22NO4.ClH/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4;/h5-6,9-12H,7-8H2,1-4H3;1H/q+1;/p-1 |
InChIKey | RLQYRXCUPVKSAW-UHFFFAOYSA-M |
SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)OC.[Cl-] |
Reference | <p style=/line-height:25px/> |