For research use only. Not for therapeutic Use.
Palmatine(CAT: R013950) is a natural isoquinoline alkaloid found in various plant species, including the Chinese herb Coptis chinensis. Its mode of action involves interacting with multiple molecular targets, such as DNA, enzymes, and ion channels, leading to various biological effects. Pharmacologically, palmatine exhibits diverse properties, including antimicrobial, anti-inflammatory, antioxidant, and antitumor activities. It has been studied for its potential therapeutic applications in treating infections, inflammation-related conditions, and cancer. Additionally, palmatine has been explored for its neuroprotective effects in some preclinical studies.
CAS Number | 3486-67-7 |
Molecular Formula | C21H22NO4+ |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | 2,3,9,10-tetramethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
InChI | InChI=1S/C21H22NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,9-12H,7-8H2,1-4H3/q+1 |
InChIKey | QUCQEUCGKKTEBI-UHFFFAOYSA-N |
SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)OC |