For research use only. Not for therapeutic Use.
Palmitic acid-1-13C（Cat No.:S000751） is a labeled variant of palmitic acid where the first carbon atom is enriched with carbon-13, denoted as C16H32O2 with the 13C isotopic label at the carboxyl end. This stable isotope-labeled compound is primarily used in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry for detailed metabolic studies. Palmitic acid-1-13C acts as an internal standard, allowing for precise quantification and tracking of lipid metabolism and synthesis in biological systems. It is crucial in pharmaceutical research, nutrition science, and metabolic disease studies, offering insights into fatty acid processing and regulation.
| Catalog Number | S000751 |
| CAS Number | 57677-53-9 |
| Molecular Formula | C1513CH32O2 |
| Purity | ≥95% |
| IUPAC Name | (113C)hexadecanoic acid |
| InChI | InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i16+1 |
| InChIKey | IPCSVZSSVZVIGE-LOYIAQTISA-N |
| SMILES | CCCCCCCCCCCCCCCC(=O)O |
