Palmitic acid-13C（Cat No.:S000752） is a carbon-13 labeled version of palmitic acid, with the molecular formula C1513CH32O2, where one or more carbon atoms are enriched with the 13C isotope. This labeled fatty acid is extensively used in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry for investigating lipid metabolism and interaction in biological systems. It serves as a precise tracer, enabling researchers to monitor and analyze the incorporation and turnover of fatty acids in cells and tissues. Palmitic acid-13C is vital for studies in pharmaceuticals, nutritional science, and metabolic research, enhancing understanding of fatty acid dynamics.
| Catalog Number | S000752 |
| CAS Number | 287100-87-2 |
| Molecular Formula | C1513CH32O2 |
| Purity | % |
| IUPAC Name | (213C)hexadecanoic acid |
| InChI | InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i15+1 |
| InChIKey | IPCSVZSSVZVIGE-XPOOIHDOSA-N |
| SMILES | CCCCCCCCCCCCCCCC(=O)O |
