For research use only. Not for therapeutic Use.
Palmitic acid-13C16(Cat No.:S000773) sodium is an isotopically labeled form of palmitic acid, a saturated fatty acid prevalent in various dietary sources such as meat, dairy, and palm oil. The “13C16 sodium” designation indicates that all 16 carbon atoms in the palmitic acid molecule are replaced with the stable carbon isotope carbon-13, and it exists as a sodium salt. This isotopic labeling facilitates precise tracking of palmitic acid metabolism and its incorporation into lipid pathways using advanced analytical techniques like mass spectrometry. Palmitic acid-13C16 sodium aids in elucidating lipid metabolism pathways and studying fatty acid-related disorders.
CAS Number | 2483736-17-8 |
Molecular Formula | 13C16H31NaO2 |
Purity | ≥95% |
InChI | InChI=1S/C16H32O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1,13+1,14+1,15+1,16+1; |
InChIKey | ZUWJMSFTDBLXRA-SJIUKAAASA-N |
SMILES | CCCCCCCCCCCCCCCC(=O)O.[Na] |