For research use only. Not for therapeutic Use.
Palmitic acid-d2(Cat No.:S000772) is an isotopically labeled form of palmitic acid, a saturated fatty acid abundant in various dietary sources like meat, dairy, and palm oil. The “d2” designation indicates that two hydrogen atoms in the palmitic acid molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of palmitic acid metabolism and its incorporation into lipid pathways using advanced analytical techniques like mass spectrometry. Palmitic acid-d2 serves as a valuable tool in lipid metabolism studies, aiding in elucidating pathways and understanding the role of fatty acids in cellular physiology.
CAS Number | 62689-96-7 |
Molecular Formula | C16H30D2O2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | 2,2-dideuteriohexadecanoic acid |
InChI | InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i15D2 |
InChIKey | IPCSVZSSVZVIGE-DOBBINOXSA-N |
SMILES | CCCCCCCCCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |