For research use only. Not for therapeutic Use.
Palmitic Acid-d3 is a deuterated form of palmitic acid, a common saturated fatty acid found in various fats and oils. In this version, three hydrogen atoms are replaced with deuterium. The deuterium labeling in Palmitic Acid-d3 is valuable for research in metabolic studies, lipidomics, and nutritional science. It allows for precise tracking and analysis of fatty acid metabolism and distribution in biological systems using techniques like mass spectrometry, aiding in the investigation of lipid metabolism, energy production, and related physiological processes.
| Catalog Number | R062427 |
| CAS Number | 75736-53-7 |
| Synonyms | Hexadecanoic-16,16,16-d3 Acid; [16,16,16-2H3]Hexadecanoic Acid |
| Molecular Formula | C16H32O2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | -20°C |
| IUPAC Name | 16,16,16-trideuteriohexadecanoic acid |
| InChI | InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i1D3 |
| InChIKey | IPCSVZSSVZVIGE-FIBGUPNXSA-N |
| SMILES | CCCCCCCCCCCCCCCC(=O)O |
