For research use only. Not for therapeutic Use.
Palmitic acid-d31 sodium(Cat No.:S000779) is a deuterium-labeled sodium salt of palmitic acid, featuring the chemical formula C16D31NaO2. In this molecule, thirty-one hydrogen atoms are replaced by deuterium, enhancing its stability and detection in various analytical methods, particularly mass spectrometry and NMR spectroscopy. This isotopic enrichment allows for detailed studies of fatty acid metabolism and interactions within biological systems. Palmitic acid-d31 sodium is primarily used in biomedical research to investigate lipid dynamics, absorption, and metabolic transformations, providing crucial insights into cellular processes involving fatty acids.
CAS Number | 467235-83-2 |
Molecular Formula | C16D31NaO2 |
Purity | ≥95% |
IUPAC Name | sodium;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-hentriacontadeuteriohexadecanoate |
InChI | InChI=1S/C16H32O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;/h2-15H2,1H3,(H,17,18);/q;+1/p-1/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D2,15D2; |
InChIKey | GGXKEBACDBNFAF-HXKBIXQXSA-M |
SMILES | CCCCCCCCCCCCCCCC(=O)[O-].[Na+] |