For research use only. Not for therapeutic Use.
Palmitoleic acid-13C16(Cat No.:S000783) is an isotopically labeled form of palmitoleic acid, a monounsaturated omega-7 fatty acid naturally present in various foods like dairy products and certain vegetable oils. The “13C16” designation indicates that all 16 carbon atoms in the palmitoleic acid molecule are replaced with the stable carbon isotope carbon-13. This isotopic labeling enables precise tracking of palmitoleic acid metabolism and its incorporation into lipid pathways using advanced analytical techniques like mass spectrometry. Palmitoleic acid-13C16 serves as a valuable tool in lipid metabolism studies, aiding in elucidating pathways and understanding the role of fatty acids in cellular physiology.
Catalog Number | S000783 |
CAS Number | 2483735-57-3 |
Molecular Formula | 13C16H30O2 |
Purity | ≥95% |
IUPAC Name | (Z)-(1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-13C16)hexadec-9-enoic acid |
InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/b8-7-/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1,12+1,13+1,14+1,15+1,16+1 |
InChIKey | SECPZKHBENQXJG-TXLJUQNKSA-N |
SMILES | CCCCCCC=CCCCCCCCC(=O)O |