For research use only. Not for therapeutic Use.
Palmostatin B (Cat.No:I012310) is a natural compound derived from the marine sponge, Axinella sp. It is known for its inhibitory effect on the enzyme acyl-CoA:cholesterol acyltransferase (ACAT), which plays a role in cholesterol metabolism. Palmostatin B has shown potential in reducing cellular cholesterol levels and may have implications in the treatment of cardiovascular diseases and dyslipidemia.
CAS Number | 1233365-12-2 |
Synonyms | (3S,4S)-3-Decyl-4-[2-(3,4-dimethoxyphenyl)ethyl]oxetan-2-one |
Molecular Formula | C23H36O4 |
Purity | ≥95% |
IUPAC Name | (3S,4S)-3-decyl-4-[2-(3,4-dimethoxyphenyl)ethyl]oxetan-2-one |
InChI | InChI=1S/C23H36O4/c1-4-5-6-7-8-9-10-11-12-19-20(27-23(19)24)15-13-18-14-16-21(25-2)22(17-18)26-3/h14,16-17,19-20H,4-13,15H2,1-3H3/t19-,20-/m0/s1 |
InChIKey | ASVWFAVGLYUDFD-PMACEKPBSA-N |
SMILES | CCCCCCCCCCC1C(OC1=O)CCC2=CC(=C(C=C2)OC)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |