For research use only. Not for therapeutic Use.
Pamapimod (Cat No.:I003588) is a novel inhibitor of p38 mitogen-activated protein kinase (MAPK). By specifically targeting and inhibiting the activity of p38 MAPK, pamapimod modulates intracellular signaling pathways involved in inflammation and immune response. This inhibition of p38 MAPK activity has the potential to suppress the production of pro-inflammatory cytokines and other mediators involved in various inflammatory diseases. Pamapimod represents a promising therapeutic approach for the treatment of conditions where dysregulated p38 MAPK signaling plays a role, such as autoimmune disorders and chronic inflammatory conditions.
| Catalog Number | I003588 |
| CAS Number | 449811-01-2 |
| Synonyms | 6-(2,4-difluorophenoxy)-2-((1,5-dihydroxypentan-3-yl)amino)-8-methylpyrido[2,3-d]pyrimidin-7(8H)-one |
| Molecular Formula | C₁₉H₂₀F₂N₄O₄ |
| Purity | ≥95% |
| Target | p38 |
| Solubility | DMSO ≥ 34 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 6-(2,4-difluorophenoxy)-2-(1,5-dihydroxypentan-3-ylamino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| InChI | InChI=1S/C19H20F2N4O4/c1-25-17-11(10-22-19(24-17)23-13(4-6-26)5-7-27)8-16(18(25)28)29-15-3-2-12(20)9-14(15)21/h2-3,8-10,13,26-27H,4-7H2,1H3,(H,22,23,24) |
| InChIKey | JYYLVUFNAHSSFE-UHFFFAOYSA-N |
| SMILES | CN1C2=NC(=NC=C2C=C(C1=O)OC3=C(C=C(C=C3)F)F)NC(CCO)CCO |
| Reference | 1: Zhang X, Fettner S, Winter E, Masjedizadeh M, Hisoire G. Metabolism and <br> <br> <br> |
