For research use only. Not for therapeutic Use.
Pamoic acid disodium salt (Cat.No:I010928) is a disodium salt form of pamoic acid, an organic compound. It is primarily used as a pharmaceutical ingredient in various medications due to its ability to enhance drug solubility and stability. Pamoic acid disodium salt finds applications in formulations such as tablets, capsules, and suspensions for improved drug delivery.
Catalog Number | I010928 |
CAS Number | 6640-22-8 |
Synonyms | 4,4/’-Methylenebis(3-hydroxy-2-naphthalenecarboxylic acid) disodium salt |
Molecular Formula | C23H14Na2O6 |
Purity | ≥95% |
Target | MAPK/ERK Pathway |
Solubility | Soluble to 100 mM in water and to 75 mM in DMSO |
Storage | Desiccate at RT |
IUPAC Name | disodium;3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate |
InChI | InChI=1S/C23H16O6.2Na/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;;/h1-10,24-25H,11H2,(H,26,27)(H,28,29);;/q;2*+1/p-2 |
InChIKey | YGLLICRFEVEWOZ-UHFFFAOYSA-L |
SMILES | C1=CC=C2C(=C1)C=C(C(=C2CC3=C(C(=CC4=CC=CC=C43)C(=O)O)[O-])[O-])C(=O)O.[Na+].[Na+] |