For research use only. Not for therapeutic Use.
Panasonic （Cat No.:I034196） is a drug known for its mutagenic properties, which has shown potential in the treatment of bacillary dysentery. Additionally, it finds application as an antibacterial growth promoter in animal feeds. This dual functionality highlights its versatility in both human medicine and agricultural practices.
| Catalog Number | I034196 |
| CAS Number | 2315-20-0 |
| Synonyms | Panazon |
| Molecular Formula | C14H13ClN6O6 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | 2-8°C |
| IUPAC Name | 3-(3-(5-Nitro-2-furyl)-1-(2-(5-nitro-2-furyl)vinyl)allylidene)carbazamidine monohydrochloride |
| InChI | InChI=1S/C14H12N6O6.ClH/c15-14(16)18-17-9(1-3-10-5-7-12(25-10)19(21)22)2-4-11-6-8-13(26-11)20(23)24;/h1-8H,(H4,15,16,18);1H/b3-1+,4-2+; |
| InChIKey | ZEGPTFVBNBCAHZ-LMFJUDGVSA-N |
| SMILES | N=C(N)N/N=C(/C=C/C1=CC=C([N+]([O-])=O)O1)/C=C/C2=CC=C([N+]([O-])=O)O2.[H]Cl |
| Reference | 1: Ohta T, Moriya M, Kaneda Y, Watanabe K, Miyazawa T, Sugiyama F, Shirasu Y. Mutagenicity screening of feed additives in the microbial system. Mutat Res. 1980 Jan;77(1):21-30. PubMed PMID: 6767184. |
